C12H19N3O3S — CID 61368040
2-[(3-amino-2-pyridinyl)sulfonyl]-N,N-diethylpropanamide (PubChem CID 61368040) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-[(3-amino-2-pyridinyl)sulfonyl]-N,N-diethylpropanamide.
| Compound Name | 2-[(3-amino-2-pyridinyl)sulfonyl]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 61368040 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-[(3-amino-2-pyridinyl)sulfonyl]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)S(=O)(=O)c1ncccc1N |
| InChI | InChI=1S/C12H19N3O3S/c1-4-15(5-2)12(16)9(3)19(17,18)11-10(13)7-6-8-14-11/h6-9H,4-5,13H2,1-3H3 |
| InChIKey | CKJINNZEJIBYQH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |