About 2-cyclopentylsulfinyl-1,3-benzothiazol-6-amine
2-cyclopentylsulfinyl-1,3-benzothiazol-6-amine (PubChem CID 61368635) has the molecular formula C12H14N2OS2
and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-cyclopentylsulfinyl-1,3-benzothiazol-6-amine.
Molecular Properties
| Compound Name | 2-cyclopentylsulfinyl-1,3-benzothiazol-6-amine |
| PubChem CID | 61368635 |
| Molecular Formula | C12H14N2OS2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-cyclopentylsulfinyl-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(S(=O)C3CCCC3)sc2c1 |
| InChI | InChI=1S/C12H14N2OS2/c13-8-5-6-10-11(7-8)16-12(14-10)17(15)9-3-1-2-4-9/h5-7,9H,1-4,13H2 |
| InChIKey | ZVJLVYPCFYMKAU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentylsulfinyl-1,3-benzothiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentylsulfinyl-1,3-benzothiazol-6-amine?
The IUPAC name of 2-cyclopentylsulfinyl-1,3-benzothiazol-6-amine (CID 61368635) is 2-cyclopentylsulfinyl-1,3-benzothiazol-6-amine.
What is the SMILES notation for 2-cyclopentylsulfinyl-1,3-benzothiazol-6-amine?
The canonical SMILES for 2-cyclopentylsulfinyl-1,3-benzothiazol-6-amine is Nc1ccc2nc(S(=O)C3CCCC3)sc2c1.
What is the InChIKey of 2-cyclopentylsulfinyl-1,3-benzothiazol-6-amine?
The InChIKey is ZVJLVYPCFYMKAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2OS2/c13-8-5-6-10-11(7-8)16-12(14-10)17(15)9-3-1-2-4-9/h5-7,9H,1-4,13H2.
What are the key properties of 2-cyclopentylsulfinyl-1,3-benzothiazol-6-amine?
2-cyclopentylsulfinyl-1,3-benzothiazol-6-amine has a molecular weight of 266.39 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentylsulfinyl-1,3-benzothiazol-6-amine is sourced from PubChem (CID 61368635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).