C25H29NO3S2 — CID 6136950
11-[(5Z)-5-(naphthalen-1-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]undecanoic acid (PubChem CID 6136950) has the molecular formula C25H29NO3S2 and a molecular weight of 455.65 g/mol. Its IUPAC name is 11-[(5Z)-5-(naphthalen-1-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]undecanoic acid.
| Compound Name | 11-[(5Z)-5-(naphthalen-1-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]undecanoic acid |
|---|---|
| PubChem CID | 6136950 |
| Molecular Formula | C25H29NO3S2 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 11-[(5Z)-5-(naphthalen-1-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]undecanoic acid |
| SMILES | O=C(O)CCCCCCCCCCN1C(=O)/C(=C/c2cccc3ccccc23)SC1=S |
| InChI | InChI=1S/C25H29NO3S2/c27-23(28)16-7-5-3-1-2-4-6-10-17-26-24(29)22(31-25(26)30)18-20-14-11-13-19-12-8-9-15-21(19)20/h8-9,11-15,18H,1-7,10,16-17H2,(H,27,28)/b22-18- |
| InChIKey | JMQDKVHTUCIING-PYCFMQQDSA-N |
| XLogP | 6.64 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|