About 2-[1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidin-2-yl]acetic acid
2-[1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidin-2-yl]acetic acid (PubChem CID 61369877) has the molecular formula C12H15N3O5
and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-[1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidin-2-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidin-2-yl]acetic acid |
| PubChem CID | 61369877 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-[1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN1C(=O)Cc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C12H15N3O5/c16-9-4-7(13-12(20)14-9)5-10(17)15-3-1-2-8(15)6-11(18)19/h4,8H,1-3,5-6H2,(H,18,19)(H2,13,14,16,20) |
| InChIKey | YHKGWMFLGDRMOG-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidin-2-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidin-2-yl]acetic acid?
The IUPAC name of 2-[1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidin-2-yl]acetic acid (CID 61369877) is 2-[1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidin-2-yl]acetic acid.
What is the SMILES notation for 2-[1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidin-2-yl]acetic acid?
The canonical SMILES for 2-[1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidin-2-yl]acetic acid is O=C(O)CC1CCCN1C(=O)Cc1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of 2-[1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidin-2-yl]acetic acid?
The InChIKey is YHKGWMFLGDRMOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O5/c16-9-4-7(13-12(20)14-9)5-10(17)15-3-1-2-8(15)6-11(18)19/h4,8H,1-3,5-6H2,(H,18,19)(H2,13,14,16,20).
What are the key properties of 2-[1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidin-2-yl]acetic acid?
2-[1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidin-2-yl]acetic acid has a molecular weight of 281.27 g/mol, XLogP of -0.93, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidin-2-yl]acetic acid is sourced from PubChem (CID 61369877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).