About 3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine
3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine (PubChem CID 613699) has the molecular formula C13H10N4
and a molecular weight of 222.25 g/mol. Its IUPAC name is 3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine.
Molecular Properties
| Compound Name | 3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine |
| PubChem CID | 613699 |
| Molecular Formula | C13H10N4 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine |
| SMILES | c1ccc(-c2nc(-c3cccnc3)n[nH]2)cc1 |
| InChI | InChI=1S/C13H10N4/c1-2-5-10(6-3-1)12-15-13(17-16-12)11-7-4-8-14-9-11/h1-9H,(H,15,16,17) |
| InChIKey | LYJGTNPLWZSTJL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine?
The IUPAC name of 3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine (CID 613699) is 3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine.
What is the SMILES notation for 3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine?
The canonical SMILES for 3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine is c1ccc(-c2nc(-c3cccnc3)n[nH]2)cc1.
What is the InChIKey of 3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine?
The InChIKey is LYJGTNPLWZSTJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4/c1-2-5-10(6-3-1)12-15-13(17-16-12)11-7-4-8-14-9-11/h1-9H,(H,15,16,17).
What are the key properties of 3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine?
3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine has a molecular weight of 222.25 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine is sourced from PubChem (CID 613699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).