C13H10N6S2 — CID 61370417
2-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]-1,3-benzothiazol-6-amine (PubChem CID 61370417) has the molecular formula C13H10N6S2 and a molecular weight of 314.40 g/mol. Its IUPAC name is 2-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]-1,3-benzothiazol-6-amine.
| Compound Name | 2-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 61370417 |
| Molecular Formula | C13H10N6S2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 2-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]-1,3-benzothiazol-6-amine |
| SMILES | Cc1cc(Sc2nc3ccc(N)cc3s2)n2ncnc2n1 |
| InChI | InChI=1S/C13H10N6S2/c1-7-4-11(19-12(17-7)15-6-16-19)21-13-18-9-3-2-8(14)5-10(9)20-13/h2-6H,14H2,1H3 |
| InChIKey | ORWPRYRSZRXOQA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|