C14H11F2N3S — CID 61370423
2-(4-amino-2,6-difluorophenyl)sulfanyl-4,6-dimethylpyridine-3-carbonitrile (PubChem CID 61370423) has the molecular formula C14H11F2N3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-(4-amino-2,6-difluorophenyl)sulfanyl-4,6-dimethylpyridine-3-carbonitrile.
| Compound Name | 2-(4-amino-2,6-difluorophenyl)sulfanyl-4,6-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 61370423 |
| Molecular Formula | C14H11F2N3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-(4-amino-2,6-difluorophenyl)sulfanyl-4,6-dimethylpyridine-3-carbonitrile |
| SMILES | Cc1cc(C)c(C#N)c(Sc2c(F)cc(N)cc2F)n1 |
| InChI | InChI=1S/C14H11F2N3S/c1-7-3-8(2)19-14(10(7)6-17)20-13-11(15)4-9(18)5-12(13)16/h3-5H,18H2,1-2H3 |
| InChIKey | LUGJHKLJTMUJOQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|