About N-[(4-methylcyclohexyl)methyl]-1,3-thiazol-2-amine
N-[(4-methylcyclohexyl)methyl]-1,3-thiazol-2-amine (PubChem CID 61371033) has the molecular formula C11H18N2S
and a molecular weight of 210.35 g/mol. Its IUPAC name is N-[(4-methylcyclohexyl)methyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-[(4-methylcyclohexyl)methyl]-1,3-thiazol-2-amine |
| PubChem CID | 61371033 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-[(4-methylcyclohexyl)methyl]-1,3-thiazol-2-amine |
| SMILES | CC1CCC(CNc2nccs2)CC1 |
| InChI | InChI=1S/C11H18N2S/c1-9-2-4-10(5-3-9)8-13-11-12-6-7-14-11/h6-7,9-10H,2-5,8H2,1H3,(H,12,13) |
| InChIKey | UPBOBXQHXNPAHU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(4-methylcyclohexyl)methyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-methylcyclohexyl)methyl]-1,3-thiazol-2-amine?
The IUPAC name of N-[(4-methylcyclohexyl)methyl]-1,3-thiazol-2-amine (CID 61371033) is N-[(4-methylcyclohexyl)methyl]-1,3-thiazol-2-amine.
What is the SMILES notation for N-[(4-methylcyclohexyl)methyl]-1,3-thiazol-2-amine?
The canonical SMILES for N-[(4-methylcyclohexyl)methyl]-1,3-thiazol-2-amine is CC1CCC(CNc2nccs2)CC1.
What is the InChIKey of N-[(4-methylcyclohexyl)methyl]-1,3-thiazol-2-amine?
The InChIKey is UPBOBXQHXNPAHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2S/c1-9-2-4-10(5-3-9)8-13-11-12-6-7-14-11/h6-7,9-10H,2-5,8H2,1H3,(H,12,13).
What are the key properties of N-[(4-methylcyclohexyl)methyl]-1,3-thiazol-2-amine?
N-[(4-methylcyclohexyl)methyl]-1,3-thiazol-2-amine has a molecular weight of 210.35 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-methylcyclohexyl)methyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 61371033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).