C15H20O4 — CID 613722
(8,8-dimethyl-2-oxo-3a,4,5,6,7,8b-hexahydro-3H-indeno[1,2-b]furan-5-yl) acetate (PubChem CID 613722) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (8,8-dimethyl-2-oxo-3a,4,5,6,7,8b-hexahydro-3H-indeno[1,2-b]furan-5-yl) acetate.
| Compound Name | (8,8-dimethyl-2-oxo-3a,4,5,6,7,8b-hexahydro-3H-indeno[1,2-b]furan-5-yl) acetate |
|---|---|
| PubChem CID | 613722 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (8,8-dimethyl-2-oxo-3a,4,5,6,7,8b-hexahydro-3H-indeno[1,2-b]furan-5-yl) acetate |
| SMILES | CC(=O)OC1CCC(C)(C)C2=C1CC1CC(=O)OC21 |
| InChI | InChI=1S/C15H20O4/c1-8(16)18-11-4-5-15(2,3)13-10(11)6-9-7-12(17)19-14(9)13/h9,11,14H,4-7H2,1-3H3 |
| InChIKey | YXFCVQOLOMKQJX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|