C13H16N2O — CID 61372317
5-methyl-2-(pyrrolidin-2-ylmethyl)-1,3-benzoxazole (PubChem CID 61372317) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-methyl-2-(pyrrolidin-2-ylmethyl)-1,3-benzoxazole.
| Compound Name | 5-methyl-2-(pyrrolidin-2-ylmethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 61372317 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 5-methyl-2-(pyrrolidin-2-ylmethyl)-1,3-benzoxazole |
| SMILES | Cc1ccc2oc(CC3CCCN3)nc2c1 |
| InChI | InChI=1S/C13H16N2O/c1-9-4-5-12-11(7-9)15-13(16-12)8-10-3-2-6-14-10/h4-5,7,10,14H,2-3,6,8H2,1H3 |
| InChIKey | RFPIXWZDHHUAKK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |