About 3-bromo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine
3-bromo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine (PubChem CID 61373168) has the molecular formula C9H9BrN4O
and a molecular weight of 269.10 g/mol. Its IUPAC name is 3-bromo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-bromo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine |
| PubChem CID | 61373168 |
| Molecular Formula | C9H9BrN4O |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 3-bromo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine |
| SMILES | Cc1noc(CNc2ncccc2Br)n1 |
| InChI | InChI=1S/C9H9BrN4O/c1-6-13-8(15-14-6)5-12-9-7(10)3-2-4-11-9/h2-4H,5H2,1H3,(H,11,12) |
| InChIKey | AXRPFVRMXGFWMQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-bromo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine?
The IUPAC name of 3-bromo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine (CID 61373168) is 3-bromo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine.
What is the SMILES notation for 3-bromo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine?
The canonical SMILES for 3-bromo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine is Cc1noc(CNc2ncccc2Br)n1.
What is the InChIKey of 3-bromo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine?
The InChIKey is AXRPFVRMXGFWMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN4O/c1-6-13-8(15-14-6)5-12-9-7(10)3-2-4-11-9/h2-4H,5H2,1H3,(H,11,12).
What are the key properties of 3-bromo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine?
3-bromo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine has a molecular weight of 269.10 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-amine is sourced from PubChem (CID 61373168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).