C9H8Cl2N4O — CID 61373651
2-azido-N-(2,6-dichloro-3-methylphenyl)acetamide (PubChem CID 61373651) has the molecular formula C9H8Cl2N4O and a molecular weight of 259.10 g/mol. Its IUPAC name is 2-azido-N-(2,6-dichloro-3-methylphenyl)acetamide.
| Compound Name | 2-azido-N-(2,6-dichloro-3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 61373651 |
| Molecular Formula | C9H8Cl2N4O |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 2-azido-N-(2,6-dichloro-3-methylphenyl)acetamide |
| SMILES | Cc1ccc(Cl)c(NC(=O)CN=[N+]=[N-])c1Cl |
| InChI | InChI=1S/C9H8Cl2N4O/c1-5-2-3-6(10)9(8(5)11)14-7(16)4-13-15-12/h2-3H,4H2,1H3,(H,14,16) |
| InChIKey | ZUANCMKJKARCPS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|