About 2-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)thiophen-3-amine
2-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)thiophen-3-amine (PubChem CID 61376060) has the molecular formula C9H12N4S
and a molecular weight of 208.29 g/mol. Its IUPAC name is 2-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)thiophen-3-amine.
Molecular Properties
| Compound Name | 2-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)thiophen-3-amine |
| PubChem CID | 61376060 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)thiophen-3-amine |
| SMILES | CCn1c(C)nnc1-c1sccc1N |
| InChI | InChI=1S/C9H12N4S/c1-3-13-6(2)11-12-9(13)8-7(10)4-5-14-8/h4-5H,3,10H2,1-2H3 |
| InChIKey | PKFVCADANQOYKZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)thiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)thiophen-3-amine?
The IUPAC name of 2-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)thiophen-3-amine (CID 61376060) is 2-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)thiophen-3-amine.
What is the SMILES notation for 2-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)thiophen-3-amine?
The canonical SMILES for 2-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)thiophen-3-amine is CCn1c(C)nnc1-c1sccc1N.
What is the InChIKey of 2-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)thiophen-3-amine?
The InChIKey is PKFVCADANQOYKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4S/c1-3-13-6(2)11-12-9(13)8-7(10)4-5-14-8/h4-5H,3,10H2,1-2H3.
What are the key properties of 2-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)thiophen-3-amine?
2-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)thiophen-3-amine has a molecular weight of 208.29 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)thiophen-3-amine is sourced from PubChem (CID 61376060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).