About N-amino-N',2-dimethylfuran-3-carboximidamide
N-amino-N',2-dimethylfuran-3-carboximidamide (PubChem CID 61376953) has the molecular formula C7H11N3O
and a molecular weight of 153.18 g/mol. Its IUPAC name is N-amino-N',2-dimethylfuran-3-carboximidamide.
Molecular Properties
| Compound Name | N-amino-N',2-dimethylfuran-3-carboximidamide |
| PubChem CID | 61376953 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | N-amino-N',2-dimethylfuran-3-carboximidamide |
| SMILES | C/N=C(\NN)c1ccoc1C |
| InChI | InChI=1S/C7H11N3O/c1-5-6(3-4-11-5)7(9-2)10-8/h3-4H,8H2,1-2H3,(H,9,10) |
| InChIKey | NGHSMLUEMDOXAC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N',2-dimethylfuran-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N',2-dimethylfuran-3-carboximidamide?
The IUPAC name of N-amino-N',2-dimethylfuran-3-carboximidamide (CID 61376953) is N-amino-N',2-dimethylfuran-3-carboximidamide.
What is the SMILES notation for N-amino-N',2-dimethylfuran-3-carboximidamide?
The canonical SMILES for N-amino-N',2-dimethylfuran-3-carboximidamide is C/N=C(\NN)c1ccoc1C.
What is the InChIKey of N-amino-N',2-dimethylfuran-3-carboximidamide?
The InChIKey is NGHSMLUEMDOXAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O/c1-5-6(3-4-11-5)7(9-2)10-8/h3-4H,8H2,1-2H3,(H,9,10).
What are the key properties of N-amino-N',2-dimethylfuran-3-carboximidamide?
N-amino-N',2-dimethylfuran-3-carboximidamide has a molecular weight of 153.18 g/mol, XLogP of 0.43, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N',2-dimethylfuran-3-carboximidamide is sourced from PubChem (CID 61376953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).