C11H15N3O2 — CID 61377452
6-(4,5-dimethyl-1,2,4-triazol-3-yl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 61377452) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 6-(4,5-dimethyl-1,2,4-triazol-3-yl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-(4,5-dimethyl-1,2,4-triazol-3-yl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 61377452 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 6-(4,5-dimethyl-1,2,4-triazol-3-yl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | Cc1nnc(C2CC=CCC2C(=O)O)n1C |
| InChI | InChI=1S/C11H15N3O2/c1-7-12-13-10(14(7)2)8-5-3-4-6-9(8)11(15)16/h3-4,8-9H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | QEYOGOHVFLVXKN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|