About 1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine
1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine (PubChem CID 61377993) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine.
Molecular Properties
| Compound Name | 1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine |
| PubChem CID | 61377993 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine |
| SMILES | CCn1c(C)nnc1C1(N)CCCC1 |
| InChI | InChI=1S/C10H18N4/c1-3-14-8(2)12-13-9(14)10(11)6-4-5-7-10/h3-7,11H2,1-2H3 |
| InChIKey | OWSNOTLUSUNDDW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine?
The IUPAC name of 1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine (CID 61377993) is 1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine.
What is the SMILES notation for 1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine?
The canonical SMILES for 1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine is CCn1c(C)nnc1C1(N)CCCC1.
What is the InChIKey of 1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine?
The InChIKey is OWSNOTLUSUNDDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c1-3-14-8(2)12-13-9(14)10(11)6-4-5-7-10/h3-7,11H2,1-2H3.
What are the key properties of 1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine?
1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine has a molecular weight of 194.28 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine is sourced from PubChem (CID 61377993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).