C12H12Cl2N4 — CID 61378021
2,4-dichloro-6-(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)aniline (PubChem CID 61378021) has the molecular formula C12H12Cl2N4 and a molecular weight of 283.16 g/mol. Its IUPAC name is 2,4-dichloro-6-(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)aniline.
| Compound Name | 2,4-dichloro-6-(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 61378021 |
| Molecular Formula | C12H12Cl2N4 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 2,4-dichloro-6-(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)aniline |
| SMILES | Cc1nnc(-c2cc(Cl)cc(Cl)c2N)n1C1CC1 |
| InChI | InChI=1S/C12H12Cl2N4/c1-6-16-17-12(18(6)8-2-3-8)9-4-7(13)5-10(14)11(9)15/h4-5,8H,2-3,15H2,1H3 |
| InChIKey | FYNYDPGSCMKJOQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|