About 5-(chloromethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine
5-(chloromethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine (PubChem CID 61378107) has the molecular formula C14H23ClN2
and a molecular weight of 254.80 g/mol. Its IUPAC name is 5-(chloromethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 5-(chloromethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine |
| PubChem CID | 61378107 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 5-(chloromethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine |
| SMILES | CC(C)CN(CC(C)C)c1ccc(CCl)cn1 |
| InChI | InChI=1S/C14H23ClN2/c1-11(2)9-17(10-12(3)4)14-6-5-13(7-15)8-16-14/h5-6,8,11-12H,7,9-10H2,1-4H3 |
| InChIKey | KYAXJJUSWLIZRQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine?
The IUPAC name of 5-(chloromethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine (CID 61378107) is 5-(chloromethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine.
What is the SMILES notation for 5-(chloromethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine?
The canonical SMILES for 5-(chloromethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine is CC(C)CN(CC(C)C)c1ccc(CCl)cn1.
What is the InChIKey of 5-(chloromethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine?
The InChIKey is KYAXJJUSWLIZRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23ClN2/c1-11(2)9-17(10-12(3)4)14-6-5-13(7-15)8-16-14/h5-6,8,11-12H,7,9-10H2,1-4H3.
What are the key properties of 5-(chloromethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine?
5-(chloromethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine has a molecular weight of 254.80 g/mol, XLogP of 3.94, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-N,N-bis(2-methylpropyl)pyridin-2-amine is sourced from PubChem (CID 61378107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).