C13H14ClNO4 — CID 61379355
4-chloro-2-[2-(cyclopropylmethylamino)-2-oxoethoxy]benzoic acid (PubChem CID 61379355) has the molecular formula C13H14ClNO4 and a molecular weight of 283.71 g/mol. Its IUPAC name is 4-chloro-2-[2-(cyclopropylmethylamino)-2-oxoethoxy]benzoic acid.
| Compound Name | 4-chloro-2-[2-(cyclopropylmethylamino)-2-oxoethoxy]benzoic acid |
|---|---|
| PubChem CID | 61379355 |
| Molecular Formula | C13H14ClNO4 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-chloro-2-[2-(cyclopropylmethylamino)-2-oxoethoxy]benzoic acid |
| SMILES | O=C(COc1cc(Cl)ccc1C(=O)O)NCC1CC1 |
| InChI | InChI=1S/C13H14ClNO4/c14-9-3-4-10(13(17)18)11(5-9)19-7-12(16)15-6-8-1-2-8/h3-5,8H,1-2,6-7H2,(H,15,16)(H,17,18) |
| InChIKey | GFNRCLMKBRORPR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |