C13H16N4O2 — CID 61381012
ethyl 2-(3,5-dimethyl-1-pyrimidin-2-ylpyrazol-4-yl)acetate (PubChem CID 61381012) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is ethyl 2-(3,5-dimethyl-1-pyrimidin-2-ylpyrazol-4-yl)acetate.
| Compound Name | ethyl 2-(3,5-dimethyl-1-pyrimidin-2-ylpyrazol-4-yl)acetate |
|---|---|
| PubChem CID | 61381012 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | ethyl 2-(3,5-dimethyl-1-pyrimidin-2-ylpyrazol-4-yl)acetate |
| SMILES | CCOC(=O)Cc1c(C)nn(-c2ncccn2)c1C |
| InChI | InChI=1S/C13H16N4O2/c1-4-19-12(18)8-11-9(2)16-17(10(11)3)13-14-6-5-7-15-13/h5-7H,4,8H2,1-3H3 |
| InChIKey | ZAWZLEHMUUQYJU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |