C12H15ClN2O4 — CID 61381103
(2S)-2-[2-(4-chlorophenyl)ethylcarbamoylamino]-3-hydroxypropanoic acid (PubChem CID 61381103) has the molecular formula C12H15ClN2O4 and a molecular weight of 286.71 g/mol. Its IUPAC name is (2S)-2-[2-(4-chlorophenyl)ethylcarbamoylamino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[2-(4-chlorophenyl)ethylcarbamoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 61381103 |
| Molecular Formula | C12H15ClN2O4 |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (2S)-2-[2-(4-chlorophenyl)ethylcarbamoylamino]-3-hydroxypropanoic acid |
| SMILES | O=C(NCCc1ccc(Cl)cc1)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C12H15ClN2O4/c13-9-3-1-8(2-4-9)5-6-14-12(19)15-10(7-16)11(17)18/h1-4,10,16H,5-7H2,(H,17,18)(H2,14,15,19)/t10-/m0/s1 |
| InChIKey | FOZHBQBQYMHRDQ-JTQLQIEISA-N |
| XLogP | 0.63 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |