About N-methyl-6-oxo-N-(3,3,3-trifluoropropyl)-1H-pyridine-3-carboxamide
N-methyl-6-oxo-N-(3,3,3-trifluoropropyl)-1H-pyridine-3-carboxamide (PubChem CID 61381316) has the molecular formula C10H11F3N2O2
and a molecular weight of 248.20 g/mol. Its IUPAC name is N-methyl-6-oxo-N-(3,3,3-trifluoropropyl)-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-methyl-6-oxo-N-(3,3,3-trifluoropropyl)-1H-pyridine-3-carboxamide |
| PubChem CID | 61381316 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | N-methyl-6-oxo-N-(3,3,3-trifluoropropyl)-1H-pyridine-3-carboxamide |
| SMILES | CN(CCC(F)(F)F)C(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C10H11F3N2O2/c1-15(5-4-10(11,12)13)9(17)7-2-3-8(16)14-6-7/h2-3,6H,4-5H2,1H3,(H,14,16) |
| InChIKey | VYLHLJSCHLVHOU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-6-oxo-N-(3,3,3-trifluoropropyl)-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-6-oxo-N-(3,3,3-trifluoropropyl)-1H-pyridine-3-carboxamide?
The IUPAC name of N-methyl-6-oxo-N-(3,3,3-trifluoropropyl)-1H-pyridine-3-carboxamide (CID 61381316) is N-methyl-6-oxo-N-(3,3,3-trifluoropropyl)-1H-pyridine-3-carboxamide.
What is the SMILES notation for N-methyl-6-oxo-N-(3,3,3-trifluoropropyl)-1H-pyridine-3-carboxamide?
The canonical SMILES for N-methyl-6-oxo-N-(3,3,3-trifluoropropyl)-1H-pyridine-3-carboxamide is CN(CCC(F)(F)F)C(=O)c1ccc(=O)[nH]c1.
What is the InChIKey of N-methyl-6-oxo-N-(3,3,3-trifluoropropyl)-1H-pyridine-3-carboxamide?
The InChIKey is VYLHLJSCHLVHOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N2O2/c1-15(5-4-10(11,12)13)9(17)7-2-3-8(16)14-6-7/h2-3,6H,4-5H2,1H3,(H,14,16).
What are the key properties of N-methyl-6-oxo-N-(3,3,3-trifluoropropyl)-1H-pyridine-3-carboxamide?
N-methyl-6-oxo-N-(3,3,3-trifluoropropyl)-1H-pyridine-3-carboxamide has a molecular weight of 248.20 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-6-oxo-N-(3,3,3-trifluoropropyl)-1H-pyridine-3-carboxamide is sourced from PubChem (CID 61381316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).