C13H11ClFNO — CID 61382713
7-chloro-5-fluoro-2,3,4,10-tetrahydro-1H-acridin-9-one (PubChem CID 61382713) has the molecular formula C13H11ClFNO and a molecular weight of 251.69 g/mol. Its IUPAC name is 7-chloro-5-fluoro-2,3,4,10-tetrahydro-1H-acridin-9-one.
| Compound Name | 7-chloro-5-fluoro-2,3,4,10-tetrahydro-1H-acridin-9-one |
|---|---|
| PubChem CID | 61382713 |
| Molecular Formula | C13H11ClFNO |
| Molecular Weight | 251.69 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 7-chloro-5-fluoro-2,3,4,10-tetrahydro-1H-acridin-9-one |
| SMILES | O=c1c2c([nH]c3c(F)cc(Cl)cc13)CCCC2 |
| InChI | InChI=1S/C13H11ClFNO/c14-7-5-9-12(10(15)6-7)16-11-4-2-1-3-8(11)13(9)17/h5-6H,1-4H2,(H,16,17) |
| InChIKey | KIYCPLXYGXLGJU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.69 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |