C14H14FNO — CID 61382722
5-fluoro-7-methyl-2,3,4,10-tetrahydro-1H-acridin-9-one (PubChem CID 61382722) has the molecular formula C14H14FNO and a molecular weight of 231.27 g/mol. Its IUPAC name is 5-fluoro-7-methyl-2,3,4,10-tetrahydro-1H-acridin-9-one.
| Compound Name | 5-fluoro-7-methyl-2,3,4,10-tetrahydro-1H-acridin-9-one |
|---|---|
| PubChem CID | 61382722 |
| Molecular Formula | C14H14FNO |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 5-fluoro-7-methyl-2,3,4,10-tetrahydro-1H-acridin-9-one |
| SMILES | Cc1cc(F)c2[nH]c3c(c(=O)c2c1)CCCC3 |
| InChI | InChI=1S/C14H14FNO/c1-8-6-10-13(11(15)7-8)16-12-5-3-2-4-9(12)14(10)17/h6-7H,2-5H2,1H3,(H,16,17) |
| InChIKey | FIFDLKGQYNXLOZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |