C14H13F2NO2 — CID 61382776
5-(difluoromethoxy)-2,3,4,10-tetrahydro-1H-acridin-9-one (PubChem CID 61382776) has the molecular formula C14H13F2NO2 and a molecular weight of 265.26 g/mol. Its IUPAC name is 5-(difluoromethoxy)-2,3,4,10-tetrahydro-1H-acridin-9-one.
| Compound Name | 5-(difluoromethoxy)-2,3,4,10-tetrahydro-1H-acridin-9-one |
|---|---|
| PubChem CID | 61382776 |
| Molecular Formula | C14H13F2NO2 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 5-(difluoromethoxy)-2,3,4,10-tetrahydro-1H-acridin-9-one |
| SMILES | O=c1c2c([nH]c3c(OC(F)F)cccc13)CCCC2 |
| InChI | InChI=1S/C14H13F2NO2/c15-14(16)19-11-7-3-5-9-12(11)17-10-6-2-1-4-8(10)13(9)18/h3,5,7,14H,1-2,4,6H2,(H,17,18) |
| InChIKey | WWTLBQNHLJMNIP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |