About 5-bromoquinolin-8-amine
5-bromoquinolin-8-amine (PubChem CID 613829) has the molecular formula C9H7BrN2
and a molecular weight of 223.07 g/mol. Its IUPAC name is 5-bromoquinolin-8-amine.
Molecular Properties
| Compound Name | 5-bromoquinolin-8-amine |
| PubChem CID | 613829 |
| Molecular Formula | C9H7BrN2 |
| Molecular Weight | 223.07 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | 5-bromoquinolin-8-amine |
| SMILES | Nc1ccc(Br)c2cccnc12 |
| InChI | InChI=1S/C9H7BrN2/c10-7-3-4-8(11)9-6(7)2-1-5-12-9/h1-5H,11H2 |
| InChIKey | GEABITRRZOHARP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.07 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-bromoquinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromoquinolin-8-amine?
The IUPAC name of 5-bromoquinolin-8-amine (CID 613829) is 5-bromoquinolin-8-amine.
What is the SMILES notation for 5-bromoquinolin-8-amine?
The canonical SMILES for 5-bromoquinolin-8-amine is Nc1ccc(Br)c2cccnc12.
What is the InChIKey of 5-bromoquinolin-8-amine?
The InChIKey is GEABITRRZOHARP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrN2/c10-7-3-4-8(11)9-6(7)2-1-5-12-9/h1-5H,11H2.
What are the key properties of 5-bromoquinolin-8-amine?
5-bromoquinolin-8-amine has a molecular weight of 223.07 g/mol, XLogP of 2.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromoquinolin-8-amine is sourced from PubChem (CID 613829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).