About 4,6-dimethoxy-2,3-dihydro-1H-inden-1-amine
4,6-dimethoxy-2,3-dihydro-1H-inden-1-amine (PubChem CID 61382953) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 4,6-dimethoxy-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | 4,6-dimethoxy-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 61382953 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4,6-dimethoxy-2,3-dihydro-1H-inden-1-amine |
| SMILES | COc1cc(OC)c2c(c1)C(N)CC2 |
| InChI | InChI=1S/C11H15NO2/c1-13-7-5-9-8(3-4-10(9)12)11(6-7)14-2/h5-6,10H,3-4,12H2,1-2H3 |
| InChIKey | BMMIJBKOOXDOQU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-dimethoxy-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethoxy-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of 4,6-dimethoxy-2,3-dihydro-1H-inden-1-amine (CID 61382953) is 4,6-dimethoxy-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for 4,6-dimethoxy-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for 4,6-dimethoxy-2,3-dihydro-1H-inden-1-amine is COc1cc(OC)c2c(c1)C(N)CC2.
What is the InChIKey of 4,6-dimethoxy-2,3-dihydro-1H-inden-1-amine?
The InChIKey is BMMIJBKOOXDOQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-13-7-5-9-8(3-4-10(9)12)11(6-7)14-2/h5-6,10H,3-4,12H2,1-2H3.
What are the key properties of 4,6-dimethoxy-2,3-dihydro-1H-inden-1-amine?
4,6-dimethoxy-2,3-dihydro-1H-inden-1-amine has a molecular weight of 193.25 g/mol, XLogP of 1.65, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethoxy-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 61382953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).