C13H18N2O4S — CID 61383225
methyl 2-[ethyl-[3-(thiophene-2-carbonylamino)propanoyl]amino]acetate (PubChem CID 61383225) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is methyl 2-[ethyl-[3-(thiophene-2-carbonylamino)propanoyl]amino]acetate.
| Compound Name | methyl 2-[ethyl-[3-(thiophene-2-carbonylamino)propanoyl]amino]acetate |
|---|---|
| PubChem CID | 61383225 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | methyl 2-[ethyl-[3-(thiophene-2-carbonylamino)propanoyl]amino]acetate |
| SMILES | CCN(CC(=O)OC)C(=O)CCNC(=O)c1cccs1 |
| InChI | InChI=1S/C13H18N2O4S/c1-3-15(9-12(17)19-2)11(16)6-7-14-13(18)10-5-4-8-20-10/h4-5,8H,3,6-7,9H2,1-2H3,(H,14,18) |
| InChIKey | XTMSSZYBQWVOTK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |