methyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate

C15H21NO5 — CID 61383632

IUPACmethyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate
SMILESCCN(CC(=O)OC)C(=O)Cc1ccc(OC)c(OC)c1
InChIInChI=1S/C15H21NO5/c1-5-16(10-15(18)21-4)14(17)9-11-6-7-12(19-2)13(8-11)20-3/h6-8H,5,9-10H2,1-4H3
InChIKeyHHTRUTHBAOEEJR-UHFFFAOYSA-N
MW295.34 g/mol
LogP1.27
Rot. Bonds7

About methyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate

methyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate (PubChem CID 61383632) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is methyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate.

Molecular Properties

Compound Namemethyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate
PubChem CID61383632
Molecular FormulaC15H21NO5
Molecular Weight295.34 g/mol
Exact Mass295.14
IUPAC Namemethyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate
SMILESCCN(CC(=O)OC)C(=O)Cc1ccc(OC)c(OC)c1
InChIInChI=1S/C15H21NO5/c1-5-16(10-15(18)21-4)14(17)9-11-6-7-12(19-2)13(8-11)20-3/h6-8H,5,9-10H2,1-4H3
InChIKeyHHTRUTHBAOEEJR-UHFFFAOYSA-N
XLogP1.27
TPSA65.07 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.34
LogP ≤ 51.27
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate?
The IUPAC name of methyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate (CID 61383632) is methyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate.
What is the SMILES notation for methyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate?
The canonical SMILES for methyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate is CCN(CC(=O)OC)C(=O)Cc1ccc(OC)c(OC)c1.
What is the InChIKey of methyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate?
The InChIKey is HHTRUTHBAOEEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO5/c1-5-16(10-15(18)21-4)14(17)9-11-6-7-12(19-2)13(8-11)20-3/h6-8H,5,9-10H2,1-4H3.
What are the key properties of methyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate?
methyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate has a molecular weight of 295.34 g/mol, XLogP of 1.27, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[2-(3,4-dimethoxyphenyl)acetyl]-ethylamino]acetate is sourced from PubChem (CID 61383632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).