About N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide
N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide (PubChem CID 61383739) has the molecular formula C9H18F3NO2S
and a molecular weight of 261.31 g/mol. Its IUPAC name is N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide |
| PubChem CID | 61383739 |
| Molecular Formula | C9H18F3NO2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)N(CC(C)C)CC(F)(F)F |
| InChI | InChI=1S/C9H18F3NO2S/c1-4-5-16(14,15)13(6-8(2)3)7-9(10,11)12/h8H,4-7H2,1-3H3 |
| InChIKey | UZVDIIMCMJRLAY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide?
The IUPAC name of N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide (CID 61383739) is N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide.
What is the SMILES notation for N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide?
The canonical SMILES for N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide is CCCS(=O)(=O)N(CC(C)C)CC(F)(F)F.
What is the InChIKey of N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide?
The InChIKey is UZVDIIMCMJRLAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3NO2S/c1-4-5-16(14,15)13(6-8(2)3)7-9(10,11)12/h8H,4-7H2,1-3H3.
What are the key properties of N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide?
N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide has a molecular weight of 261.31 g/mol, XLogP of 2.25, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide is sourced from PubChem (CID 61383739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).