About N-(4-amino-2,6-dichlorophenyl)-3-(1-methylpyrazol-4-yl)sulfanylpropanamide
N-(4-amino-2,6-dichlorophenyl)-3-(1-methylpyrazol-4-yl)sulfanylpropanamide (PubChem CID 61384728) has the molecular formula C13H14Cl2N4OS
and a molecular weight of 345.26 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-3-(1-methylpyrazol-4-yl)sulfanylpropanamide.
Molecular Properties
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-3-(1-methylpyrazol-4-yl)sulfanylpropanamide |
| PubChem CID | 61384728 |
| Molecular Formula | C13H14Cl2N4OS |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-3-(1-methylpyrazol-4-yl)sulfanylpropanamide |
| SMILES | Cn1cc(SCCC(=O)Nc2c(Cl)cc(N)cc2Cl)cn1 |
| InChI | InChI=1S/C13H14Cl2N4OS/c1-19-7-9(6-17-19)21-3-2-12(20)18-13-10(14)4-8(16)5-11(13)15/h4-7H,2-3,16H2,1H3,(H,18,20) |
| InChIKey | YIIOOFNSHBZJOD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(4-amino-2,6-dichlorophenyl)-3-(1-methylpyrazol-4-yl)sulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-2,6-dichlorophenyl)-3-(1-methylpyrazol-4-yl)sulfanylpropanamide?
The IUPAC name of N-(4-amino-2,6-dichlorophenyl)-3-(1-methylpyrazol-4-yl)sulfanylpropanamide (CID 61384728) is N-(4-amino-2,6-dichlorophenyl)-3-(1-methylpyrazol-4-yl)sulfanylpropanamide.
What is the SMILES notation for N-(4-amino-2,6-dichlorophenyl)-3-(1-methylpyrazol-4-yl)sulfanylpropanamide?
The canonical SMILES for N-(4-amino-2,6-dichlorophenyl)-3-(1-methylpyrazol-4-yl)sulfanylpropanamide is Cn1cc(SCCC(=O)Nc2c(Cl)cc(N)cc2Cl)cn1.
What is the InChIKey of N-(4-amino-2,6-dichlorophenyl)-3-(1-methylpyrazol-4-yl)sulfanylpropanamide?
The InChIKey is YIIOOFNSHBZJOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2N4OS/c1-19-7-9(6-17-19)21-3-2-12(20)18-13-10(14)4-8(16)5-11(13)15/h4-7H,2-3,16H2,1H3,(H,18,20).
What are the key properties of N-(4-amino-2,6-dichlorophenyl)-3-(1-methylpyrazol-4-yl)sulfanylpropanamide?
N-(4-amino-2,6-dichlorophenyl)-3-(1-methylpyrazol-4-yl)sulfanylpropanamide has a molecular weight of 345.26 g/mol, XLogP of 3.43, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-2,6-dichlorophenyl)-3-(1-methylpyrazol-4-yl)sulfanylpropanamide is sourced from PubChem (CID 61384728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).