About 7-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one
7-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 613848) has the molecular formula C16H14N2O
and a molecular weight of 250.30 g/mol. Its IUPAC name is 7-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 7-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| PubChem CID | 613848 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 7-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | Cc1ccc2c(c1)C(c1ccccc1)=NCC(=O)N2 |
| InChI | InChI=1S/C16H14N2O/c1-11-7-8-14-13(9-11)16(17-10-15(19)18-14)12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,18,19) |
| InChIKey | ZZLQGKUTUGIQNL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one?
The IUPAC name of 7-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (CID 613848) is 7-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
What is the SMILES notation for 7-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one?
The canonical SMILES for 7-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one is Cc1ccc2c(c1)C(c1ccccc1)=NCC(=O)N2.
What is the InChIKey of 7-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one?
The InChIKey is ZZLQGKUTUGIQNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O/c1-11-7-8-14-13(9-11)16(17-10-15(19)18-14)12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,18,19).
What are the key properties of 7-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one?
7-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one has a molecular weight of 250.30 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one is sourced from PubChem (CID 613848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).