C32H28N2O6 — CID 6138500
(4Z)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 6138500) has the molecular formula C32H28N2O6 and a molecular weight of 536.58 g/mol. Its IUPAC name is (4Z)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6138500 |
| Molecular Formula | C32H28N2O6 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | (4Z)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2/C(=C(/O)c3ccc(OCc4ccccc4C)cc3)C(=O)C(=O)N2Cc2cccnc2)ccc1O |
| InChI | InChI=1S/C32H28N2O6/c1-20-6-3-4-8-24(20)19-40-25-12-9-22(10-13-25)30(36)28-29(23-11-14-26(35)27(16-23)39-2)34(32(38)31(28)37)18-21-7-5-15-33-17-21/h3-17,29,35-36H,18-19H2,1-2H3/b30-28- |
| InChIKey | LLQWUZWEHUUGHT-HYOGKJQXSA-N |
| XLogP | 5.31 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|