About 2-amino-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]ethanol
2-amino-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 61385059) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-amino-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]ethanol.
Molecular Properties
| Compound Name | 2-amino-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]ethanol |
| PubChem CID | 61385059 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-amino-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | NC(CO)c1nc(CCc2ccccc2)no1 |
| InChI | InChI=1S/C12H15N3O2/c13-10(8-16)12-14-11(15-17-12)7-6-9-4-2-1-3-5-9/h1-5,10,16H,6-8,13H2 |
| InChIKey | LVMPUEOFEHBJAJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]ethanol?
The IUPAC name of 2-amino-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]ethanol (CID 61385059) is 2-amino-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]ethanol.
What is the SMILES notation for 2-amino-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]ethanol?
The canonical SMILES for 2-amino-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]ethanol is NC(CO)c1nc(CCc2ccccc2)no1.
What is the InChIKey of 2-amino-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]ethanol?
The InChIKey is LVMPUEOFEHBJAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2/c13-10(8-16)12-14-11(15-17-12)7-6-9-4-2-1-3-5-9/h1-5,10,16H,6-8,13H2.
What are the key properties of 2-amino-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]ethanol?
2-amino-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]ethanol has a molecular weight of 233.27 g/mol, XLogP of 0.85, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]ethanol is sourced from PubChem (CID 61385059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).