C19H15N3O5S — CID 613860
N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide (PubChem CID 613860) has the molecular formula C19H15N3O5S and a molecular weight of 397.41 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide.
| Compound Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 613860 |
| Molecular Formula | C19H15N3O5S |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(N3C(=O)c4ccccc4C3=O)cc2)c1C |
| InChI | InChI=1S/C19H15N3O5S/c1-11-12(2)20-27-17(11)21-28(25,26)14-9-7-13(8-10-14)22-18(23)15-5-3-4-6-16(15)19(22)24/h3-10,21H,1-2H3 |
| InChIKey | KUVITUNAMCSJJV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|