About N-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethyl]propan-2-amine
N-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethyl]propan-2-amine (PubChem CID 61386359) has the molecular formula C7H13N3S2
and a molecular weight of 203.34 g/mol. Its IUPAC name is N-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethyl]propan-2-amine |
| PubChem CID | 61386359 |
| Molecular Formula | C7H13N3S2 |
| Molecular Weight | 203.34 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | N-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethyl]propan-2-amine |
| SMILES | CC(C)NCCSc1nncs1 |
| InChI | InChI=1S/C7H13N3S2/c1-6(2)8-3-4-11-7-10-9-5-12-7/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | CGVATLILKOIPIY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethyl]propan-2-amine?
The IUPAC name of N-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethyl]propan-2-amine (CID 61386359) is N-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethyl]propan-2-amine.
What is the SMILES notation for N-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethyl]propan-2-amine?
The canonical SMILES for N-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethyl]propan-2-amine is CC(C)NCCSc1nncs1.
What is the InChIKey of N-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethyl]propan-2-amine?
The InChIKey is CGVATLILKOIPIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3S2/c1-6(2)8-3-4-11-7-10-9-5-12-7/h5-6,8H,3-4H2,1-2H3.
What are the key properties of N-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethyl]propan-2-amine?
N-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethyl]propan-2-amine has a molecular weight of 203.34 g/mol, XLogP of 1.63, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,3,4-thiadiazol-2-ylsulfanyl)ethyl]propan-2-amine is sourced from PubChem (CID 61386359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).