About N-propan-2-yl-3-(1,2,4-triazol-1-yl)propan-1-amine
N-propan-2-yl-3-(1,2,4-triazol-1-yl)propan-1-amine (PubChem CID 61387138) has the molecular formula C8H16N4
and a molecular weight of 168.24 g/mol. Its IUPAC name is N-propan-2-yl-3-(1,2,4-triazol-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | N-propan-2-yl-3-(1,2,4-triazol-1-yl)propan-1-amine |
| PubChem CID | 61387138 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | N-propan-2-yl-3-(1,2,4-triazol-1-yl)propan-1-amine |
| SMILES | CC(C)NCCCn1cncn1 |
| InChI | InChI=1S/C8H16N4/c1-8(2)10-4-3-5-12-7-9-6-11-12/h6-8,10H,3-5H2,1-2H3 |
| InChIKey | PNIGYRXFSAABTR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-propan-2-yl-3-(1,2,4-triazol-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-3-(1,2,4-triazol-1-yl)propan-1-amine?
The IUPAC name of N-propan-2-yl-3-(1,2,4-triazol-1-yl)propan-1-amine (CID 61387138) is N-propan-2-yl-3-(1,2,4-triazol-1-yl)propan-1-amine.
What is the SMILES notation for N-propan-2-yl-3-(1,2,4-triazol-1-yl)propan-1-amine?
The canonical SMILES for N-propan-2-yl-3-(1,2,4-triazol-1-yl)propan-1-amine is CC(C)NCCCn1cncn1.
What is the InChIKey of N-propan-2-yl-3-(1,2,4-triazol-1-yl)propan-1-amine?
The InChIKey is PNIGYRXFSAABTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4/c1-8(2)10-4-3-5-12-7-9-6-11-12/h6-8,10H,3-5H2,1-2H3.
What are the key properties of N-propan-2-yl-3-(1,2,4-triazol-1-yl)propan-1-amine?
N-propan-2-yl-3-(1,2,4-triazol-1-yl)propan-1-amine has a molecular weight of 168.24 g/mol, XLogP of 0.67, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-3-(1,2,4-triazol-1-yl)propan-1-amine is sourced from PubChem (CID 61387138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).