About N'-(1-cyclopropylethyl)-N'-methyl-N-propylpropane-1,3-diamine
N'-(1-cyclopropylethyl)-N'-methyl-N-propylpropane-1,3-diamine (PubChem CID 61387261) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is N'-(1-cyclopropylethyl)-N'-methyl-N-propylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(1-cyclopropylethyl)-N'-methyl-N-propylpropane-1,3-diamine |
| PubChem CID | 61387261 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | N'-(1-cyclopropylethyl)-N'-methyl-N-propylpropane-1,3-diamine |
| SMILES | CCCNCCCN(C)C(C)C1CC1 |
| InChI | InChI=1S/C12H26N2/c1-4-8-13-9-5-10-14(3)11(2)12-6-7-12/h11-13H,4-10H2,1-3H3 |
| InChIKey | PAACMUWOTOYODU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(1-cyclopropylethyl)-N'-methyl-N-propylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-cyclopropylethyl)-N'-methyl-N-propylpropane-1,3-diamine?
The IUPAC name of N'-(1-cyclopropylethyl)-N'-methyl-N-propylpropane-1,3-diamine (CID 61387261) is N'-(1-cyclopropylethyl)-N'-methyl-N-propylpropane-1,3-diamine.
What is the SMILES notation for N'-(1-cyclopropylethyl)-N'-methyl-N-propylpropane-1,3-diamine?
The canonical SMILES for N'-(1-cyclopropylethyl)-N'-methyl-N-propylpropane-1,3-diamine is CCCNCCCN(C)C(C)C1CC1.
What is the InChIKey of N'-(1-cyclopropylethyl)-N'-methyl-N-propylpropane-1,3-diamine?
The InChIKey is PAACMUWOTOYODU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2/c1-4-8-13-9-5-10-14(3)11(2)12-6-7-12/h11-13H,4-10H2,1-3H3.
What are the key properties of N'-(1-cyclopropylethyl)-N'-methyl-N-propylpropane-1,3-diamine?
N'-(1-cyclopropylethyl)-N'-methyl-N-propylpropane-1,3-diamine has a molecular weight of 198.35 g/mol, XLogP of 2.11, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-cyclopropylethyl)-N'-methyl-N-propylpropane-1,3-diamine is sourced from PubChem (CID 61387261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).