1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid

C12H12N2O3 — CID 61389334

IUPAC1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid
SMILESCc1ccc(N2N=C(C(=O)O)CC2=O)c(C)c1
InChIInChI=1S/C12H12N2O3/c1-7-3-4-10(8(2)5-7)14-11(15)6-9(13-14)12(16)17/h3-5H,6H2,1-2H3,(H,16,17)
InChIKeyHZMZNNDGNPSEJJ-UHFFFAOYSA-N
MW232.24 g/mol
LogP1.48
Rot. Bonds2

About 1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid

1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid (PubChem CID 61389334) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid.

Molecular Properties

Compound Name1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid
PubChem CID61389334
Molecular FormulaC12H12N2O3
Molecular Weight232.24 g/mol
Exact Mass232.08
IUPAC Name1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid
SMILESCc1ccc(N2N=C(C(=O)O)CC2=O)c(C)c1
InChIInChI=1S/C12H12N2O3/c1-7-3-4-10(8(2)5-7)14-11(15)6-9(13-14)12(16)17/h3-5H,6H2,1-2H3,(H,16,17)
InChIKeyHZMZNNDGNPSEJJ-UHFFFAOYSA-N
XLogP1.48
TPSA69.97 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.24
LogP ≤ 51.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het_5_A(7)', 'substructure': 'N/A'}

Analyze 1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid?
The IUPAC name of 1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid (CID 61389334) is 1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid.
What is the SMILES notation for 1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid?
The canonical SMILES for 1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid is Cc1ccc(N2N=C(C(=O)O)CC2=O)c(C)c1.
What is the InChIKey of 1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid?
The InChIKey is HZMZNNDGNPSEJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3/c1-7-3-4-10(8(2)5-7)14-11(15)6-9(13-14)12(16)17/h3-5H,6H2,1-2H3,(H,16,17).
What are the key properties of 1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid?
1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid has a molecular weight of 232.24 g/mol, XLogP of 1.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethylphenyl)-5-oxo-4H-pyrazole-3-carboxylic acid is sourced from PubChem (CID 61389334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).