C12H18BrNO2 — CID 61390227
1-[2-bromo-6-(methylaminomethyl)phenoxy]butan-2-ol (PubChem CID 61390227) has the molecular formula C12H18BrNO2 and a molecular weight of 288.18 g/mol. Its IUPAC name is 1-[2-bromo-6-(methylaminomethyl)phenoxy]butan-2-ol.
| Compound Name | 1-[2-bromo-6-(methylaminomethyl)phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 61390227 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 1-[2-bromo-6-(methylaminomethyl)phenoxy]butan-2-ol |
| SMILES | CCC(O)COc1c(Br)cccc1CNC |
| InChI | InChI=1S/C12H18BrNO2/c1-3-10(15)8-16-12-9(7-14-2)5-4-6-11(12)13/h4-6,10,14-15H,3,7-8H2,1-2H3 |
| InChIKey | WZENUPBPVYOLLX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |