C15H21BrN2O — CID 61390738
2-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]-6-bromophenol (PubChem CID 61390738) has the molecular formula C15H21BrN2O and a molecular weight of 325.25 g/mol. Its IUPAC name is 2-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]-6-bromophenol.
| Compound Name | 2-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]-6-bromophenol |
|---|---|
| PubChem CID | 61390738 |
| Molecular Formula | C15H21BrN2O |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]-6-bromophenol |
| SMILES | Oc1c(Br)cccc1CNC1CCN2CCCCC12 |
| InChI | InChI=1S/C15H21BrN2O/c16-12-5-3-4-11(15(12)19)10-17-13-7-9-18-8-2-1-6-14(13)18/h3-5,13-14,17,19H,1-2,6-10H2 |
| InChIKey | YOLNYERESDMMCT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|