C12H15ClF3N — CID 61392785
1-(3-chlorophenyl)-N-ethyl-4,4,4-trifluorobutan-2-amine (PubChem CID 61392785) has the molecular formula C12H15ClF3N and a molecular weight of 265.71 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-ethyl-4,4,4-trifluorobutan-2-amine.
| Compound Name | 1-(3-chlorophenyl)-N-ethyl-4,4,4-trifluorobutan-2-amine |
|---|---|
| PubChem CID | 61392785 |
| Molecular Formula | C12H15ClF3N |
| Molecular Weight | 265.71 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 1-(3-chlorophenyl)-N-ethyl-4,4,4-trifluorobutan-2-amine |
| SMILES | CCNC(Cc1cccc(Cl)c1)CC(F)(F)F |
| InChI | InChI=1S/C12H15ClF3N/c1-2-17-11(8-12(14,15)16)7-9-4-3-5-10(13)6-9/h3-6,11,17H,2,7-8H2,1H3 |
| InChIKey | ZHOUWSBUUVUJDP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.71 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |