C9H10ClF3N2 — CID 61392924
4-chloro-6-propyl-2-(2,2,2-trifluoroethyl)pyrimidine (PubChem CID 61392924) has the molecular formula C9H10ClF3N2 and a molecular weight of 238.64 g/mol. Its IUPAC name is 4-chloro-6-propyl-2-(2,2,2-trifluoroethyl)pyrimidine.
| Compound Name | 4-chloro-6-propyl-2-(2,2,2-trifluoroethyl)pyrimidine |
|---|---|
| PubChem CID | 61392924 |
| Molecular Formula | C9H10ClF3N2 |
| Molecular Weight | 238.64 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 4-chloro-6-propyl-2-(2,2,2-trifluoroethyl)pyrimidine |
| SMILES | CCCc1cc(Cl)nc(CC(F)(F)F)n1 |
| InChI | InChI=1S/C9H10ClF3N2/c1-2-3-6-4-7(10)15-8(14-6)5-9(11,12)13/h4H,2-3,5H2,1H3 |
| InChIKey | PIXSOEYRIIFZHI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.64 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |