About 4-(3-fluorophenyl)-1,2-oxazol-5-amine
4-(3-fluorophenyl)-1,2-oxazol-5-amine (PubChem CID 61393382) has the molecular formula C9H7FN2O
and a molecular weight of 178.17 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 4-(3-fluorophenyl)-1,2-oxazol-5-amine |
| PubChem CID | 61393382 |
| Molecular Formula | C9H7FN2O |
| Molecular Weight | 178.17 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 4-(3-fluorophenyl)-1,2-oxazol-5-amine |
| SMILES | Nc1oncc1-c1cccc(F)c1 |
| InChI | InChI=1S/C9H7FN2O/c10-7-3-1-2-6(4-7)8-5-12-13-9(8)11/h1-5H,11H2 |
| InChIKey | WSEKPMMEQGXONX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.17 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-fluorophenyl)-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluorophenyl)-1,2-oxazol-5-amine?
The IUPAC name of 4-(3-fluorophenyl)-1,2-oxazol-5-amine (CID 61393382) is 4-(3-fluorophenyl)-1,2-oxazol-5-amine.
What is the SMILES notation for 4-(3-fluorophenyl)-1,2-oxazol-5-amine?
The canonical SMILES for 4-(3-fluorophenyl)-1,2-oxazol-5-amine is Nc1oncc1-c1cccc(F)c1.
What is the InChIKey of 4-(3-fluorophenyl)-1,2-oxazol-5-amine?
The InChIKey is WSEKPMMEQGXONX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FN2O/c10-7-3-1-2-6(4-7)8-5-12-13-9(8)11/h1-5H,11H2.
What are the key properties of 4-(3-fluorophenyl)-1,2-oxazol-5-amine?
4-(3-fluorophenyl)-1,2-oxazol-5-amine has a molecular weight of 178.17 g/mol, XLogP of 2.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluorophenyl)-1,2-oxazol-5-amine is sourced from PubChem (CID 61393382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).