C9H4Cl2FN3O2 — CID 61394838
5-(2,4-dichloro-5-fluorophenyl)-4-nitro-1H-pyrazole (PubChem CID 61394838) has the molecular formula C9H4Cl2FN3O2 and a molecular weight of 276.05 g/mol. Its IUPAC name is 5-(2,4-dichloro-5-fluorophenyl)-4-nitro-1H-pyrazole.
| Compound Name | 5-(2,4-dichloro-5-fluorophenyl)-4-nitro-1H-pyrazole |
|---|---|
| PubChem CID | 61394838 |
| Molecular Formula | C9H4Cl2FN3O2 |
| Molecular Weight | 276.05 g/mol |
| Exact Mass | 274.97 |
| IUPAC Name | 5-(2,4-dichloro-5-fluorophenyl)-4-nitro-1H-pyrazole |
| SMILES | O=[N+]([O-])c1cn[nH]c1-c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H4Cl2FN3O2/c10-5-2-6(11)7(12)1-4(5)9-8(15(16)17)3-13-14-9/h1-3H,(H,13,14) |
| InChIKey | FGQCPZKDBHQBFE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.05 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|