C23H19Cl2N3O5S — CID 6139507
4-[(Z)-[[2-[(2-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 6139507) has the molecular formula C23H19Cl2N3O5S and a molecular weight of 520.39 g/mol. Its IUPAC name is 4-[(Z)-[[2-[(2-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[(Z)-[[2-[(2-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 6139507 |
| Molecular Formula | C23H19Cl2N3O5S |
| Molecular Weight | 520.39 g/mol |
| Exact Mass | 519.04 |
| IUPAC Name | 4-[(Z)-[[2-[(2-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | O=C(CN(Cc1ccccc1Cl)S(=O)(=O)c1ccc(Cl)cc1)N/N=C\c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H19Cl2N3O5S/c24-19-9-11-20(12-10-19)34(32,33)28(14-18-3-1-2-4-21(18)25)15-22(29)27-26-13-16-5-7-17(8-6-16)23(30)31/h1-13H,14-15H2,(H,27,29)(H,30,31)/b26-13- |
| InChIKey | GTVQYVJBYOYWAY-ZMFRSBBQSA-N |
| XLogP | 4.03 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|