About ethyl 5-[methyl(3,3,3-trifluoropropyl)sulfamoyl]-1H-pyrazole-4-carboxylate
ethyl 5-[methyl(3,3,3-trifluoropropyl)sulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 61395371) has the molecular formula C10H14F3N3O4S
and a molecular weight of 329.30 g/mol. Its IUPAC name is ethyl 5-[methyl(3,3,3-trifluoropropyl)sulfamoyl]-1H-pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[methyl(3,3,3-trifluoropropyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
| PubChem CID | 61395371 |
| Molecular Formula | C10H14F3N3O4S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | ethyl 5-[methyl(3,3,3-trifluoropropyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)N(C)CCC(F)(F)F |
| InChI | InChI=1S/C10H14F3N3O4S/c1-3-20-9(17)7-6-14-15-8(7)21(18,19)16(2)5-4-10(11,12)13/h6H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | UGUDRKABGDXGBB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-[methyl(3,3,3-trifluoropropyl)sulfamoyl]-1H-pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[methyl(3,3,3-trifluoropropyl)sulfamoyl]-1H-pyrazole-4-carboxylate?
The IUPAC name of ethyl 5-[methyl(3,3,3-trifluoropropyl)sulfamoyl]-1H-pyrazole-4-carboxylate (CID 61395371) is ethyl 5-[methyl(3,3,3-trifluoropropyl)sulfamoyl]-1H-pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 5-[methyl(3,3,3-trifluoropropyl)sulfamoyl]-1H-pyrazole-4-carboxylate?
The canonical SMILES for ethyl 5-[methyl(3,3,3-trifluoropropyl)sulfamoyl]-1H-pyrazole-4-carboxylate is CCOC(=O)c1cn[nH]c1S(=O)(=O)N(C)CCC(F)(F)F.
What is the InChIKey of ethyl 5-[methyl(3,3,3-trifluoropropyl)sulfamoyl]-1H-pyrazole-4-carboxylate?
The InChIKey is UGUDRKABGDXGBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N3O4S/c1-3-20-9(17)7-6-14-15-8(7)21(18,19)16(2)5-4-10(11,12)13/h6H,3-5H2,1-2H3,(H,14,15).
What are the key properties of ethyl 5-[methyl(3,3,3-trifluoropropyl)sulfamoyl]-1H-pyrazole-4-carboxylate?
ethyl 5-[methyl(3,3,3-trifluoropropyl)sulfamoyl]-1H-pyrazole-4-carboxylate has a molecular weight of 329.30 g/mol, XLogP of 1.16, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[methyl(3,3,3-trifluoropropyl)sulfamoyl]-1H-pyrazole-4-carboxylate is sourced from PubChem (CID 61395371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).