About 1-(3-azidopropyl)-3,5-dimethylpiperidine
1-(3-azidopropyl)-3,5-dimethylpiperidine (PubChem CID 61396749) has the molecular formula C10H20N4
and a molecular weight of 196.30 g/mol. Its IUPAC name is 1-(3-azidopropyl)-3,5-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-(3-azidopropyl)-3,5-dimethylpiperidine |
| PubChem CID | 61396749 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 1-(3-azidopropyl)-3,5-dimethylpiperidine |
| SMILES | CC1CC(C)CN(CCCN=[N+]=[N-])C1 |
| InChI | InChI=1S/C10H20N4/c1-9-6-10(2)8-14(7-9)5-3-4-12-13-11/h9-10H,3-8H2,1-2H3 |
| InChIKey | SOZGECUIMVNKAA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-azidopropyl)-3,5-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-azidopropyl)-3,5-dimethylpiperidine?
The IUPAC name of 1-(3-azidopropyl)-3,5-dimethylpiperidine (CID 61396749) is 1-(3-azidopropyl)-3,5-dimethylpiperidine.
What is the SMILES notation for 1-(3-azidopropyl)-3,5-dimethylpiperidine?
The canonical SMILES for 1-(3-azidopropyl)-3,5-dimethylpiperidine is CC1CC(C)CN(CCCN=[N+]=[N-])C1.
What is the InChIKey of 1-(3-azidopropyl)-3,5-dimethylpiperidine?
The InChIKey is SOZGECUIMVNKAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4/c1-9-6-10(2)8-14(7-9)5-3-4-12-13-11/h9-10H,3-8H2,1-2H3.
What are the key properties of 1-(3-azidopropyl)-3,5-dimethylpiperidine?
1-(3-azidopropyl)-3,5-dimethylpiperidine has a molecular weight of 196.30 g/mol, XLogP of 2.66, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-azidopropyl)-3,5-dimethylpiperidine is sourced from PubChem (CID 61396749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).