About 4-(3-azidopropylsulfonyl)-1,2-difluorobenzene
4-(3-azidopropylsulfonyl)-1,2-difluorobenzene (PubChem CID 61397032) has the molecular formula C9H9F2N3O2S
and a molecular weight of 261.25 g/mol. Its IUPAC name is 4-(3-azidopropylsulfonyl)-1,2-difluorobenzene.
Molecular Properties
| Compound Name | 4-(3-azidopropylsulfonyl)-1,2-difluorobenzene |
| PubChem CID | 61397032 |
| Molecular Formula | C9H9F2N3O2S |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 4-(3-azidopropylsulfonyl)-1,2-difluorobenzene |
| SMILES | [N-]=[N+]=NCCCS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H9F2N3O2S/c10-8-3-2-7(6-9(8)11)17(15,16)5-1-4-13-14-12/h2-3,6H,1,4-5H2 |
| InChIKey | APUZVSKCSVJUHM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-azidopropylsulfonyl)-1,2-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-azidopropylsulfonyl)-1,2-difluorobenzene?
The IUPAC name of 4-(3-azidopropylsulfonyl)-1,2-difluorobenzene (CID 61397032) is 4-(3-azidopropylsulfonyl)-1,2-difluorobenzene.
What is the SMILES notation for 4-(3-azidopropylsulfonyl)-1,2-difluorobenzene?
The canonical SMILES for 4-(3-azidopropylsulfonyl)-1,2-difluorobenzene is [N-]=[N+]=NCCCS(=O)(=O)c1ccc(F)c(F)c1.
What is the InChIKey of 4-(3-azidopropylsulfonyl)-1,2-difluorobenzene?
The InChIKey is APUZVSKCSVJUHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2N3O2S/c10-8-3-2-7(6-9(8)11)17(15,16)5-1-4-13-14-12/h2-3,6H,1,4-5H2.
What are the key properties of 4-(3-azidopropylsulfonyl)-1,2-difluorobenzene?
4-(3-azidopropylsulfonyl)-1,2-difluorobenzene has a molecular weight of 261.25 g/mol, XLogP of 2.44, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-azidopropylsulfonyl)-1,2-difluorobenzene is sourced from PubChem (CID 61397032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).