About 5-[(3,4-difluorophenyl)sulfonylmethyl]-1,2-oxazole-3-carboxylic acid
5-[(3,4-difluorophenyl)sulfonylmethyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 61397491) has the molecular formula C11H7F2NO5S
and a molecular weight of 303.24 g/mol. Its IUPAC name is 5-[(3,4-difluorophenyl)sulfonylmethyl]-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(3,4-difluorophenyl)sulfonylmethyl]-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 61397491 |
| Molecular Formula | C11H7F2NO5S |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 5-[(3,4-difluorophenyl)sulfonylmethyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(CS(=O)(=O)c2ccc(F)c(F)c2)on1 |
| InChI | InChI=1S/C11H7F2NO5S/c12-8-2-1-7(4-9(8)13)20(17,18)5-6-3-10(11(15)16)14-19-6/h1-4H,5H2,(H,15,16) |
| InChIKey | NSEMGHXUSORGFN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(3,4-difluorophenyl)sulfonylmethyl]-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,4-difluorophenyl)sulfonylmethyl]-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-[(3,4-difluorophenyl)sulfonylmethyl]-1,2-oxazole-3-carboxylic acid (CID 61397491) is 5-[(3,4-difluorophenyl)sulfonylmethyl]-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-[(3,4-difluorophenyl)sulfonylmethyl]-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-[(3,4-difluorophenyl)sulfonylmethyl]-1,2-oxazole-3-carboxylic acid is O=C(O)c1cc(CS(=O)(=O)c2ccc(F)c(F)c2)on1.
What is the InChIKey of 5-[(3,4-difluorophenyl)sulfonylmethyl]-1,2-oxazole-3-carboxylic acid?
The InChIKey is NSEMGHXUSORGFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F2NO5S/c12-8-2-1-7(4-9(8)13)20(17,18)5-6-3-10(11(15)16)14-19-6/h1-4H,5H2,(H,15,16).
What are the key properties of 5-[(3,4-difluorophenyl)sulfonylmethyl]-1,2-oxazole-3-carboxylic acid?
5-[(3,4-difluorophenyl)sulfonylmethyl]-1,2-oxazole-3-carboxylic acid has a molecular weight of 303.24 g/mol, XLogP of 1.62, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-difluorophenyl)sulfonylmethyl]-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 61397491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).